C18H18O4S — CID 10568423
(R)-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]-phenylmethanol (PubChem CID 10568423) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is (R)-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 10568423 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (R)-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]-phenylmethanol |
| SMILES | C=C[C@@H]1O[C@@]1([C@H](O)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18O4S/c1-3-16-18(22-16,17(19)14-7-5-4-6-8-14)23(20,21)15-11-9-13(2)10-12-15/h3-12,16-17,19H,1H2,2H3/t16-,17+,18+/m0/s1 |
| InChIKey | VTYFQTPMZQEXKP-RCCFBDPRSA-N |
| XLogP | 2.78 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|