C20H24O5S — CID 134844186
(2R,3R,4S)-4-(benzenesulfonylmethyl)-1-phenylmethoxyhex-5-ene-2,3-diol (PubChem CID 134844186) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is (2R,3R,4S)-4-(benzenesulfonylmethyl)-1-phenylmethoxyhex-5-ene-2,3-diol.
| Compound Name | (2R,3R,4S)-4-(benzenesulfonylmethyl)-1-phenylmethoxyhex-5-ene-2,3-diol |
|---|---|
| PubChem CID | 134844186 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (2R,3R,4S)-4-(benzenesulfonylmethyl)-1-phenylmethoxyhex-5-ene-2,3-diol |
| SMILES | C=C[C@H](CS(=O)(=O)c1ccccc1)[C@@H](O)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H24O5S/c1-2-17(15-26(23,24)18-11-7-4-8-12-18)20(22)19(21)14-25-13-16-9-5-3-6-10-16/h2-12,17,19-22H,1,13-15H2/t17-,19-,20-/m1/s1 |
| InChIKey | DSMAVMYVRIBXFQ-MISYRCLQSA-N |
| XLogP | 2.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|