C22H26O5S — CID 134844360
(2R,3R,4R,5R)-4-(benzenesulfonylmethyl)-2-(phenylmethoxymethyl)-5-prop-2-enyloxolan-3-ol (PubChem CID 134844360) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-(benzenesulfonylmethyl)-2-(phenylmethoxymethyl)-5-prop-2-enyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-(benzenesulfonylmethyl)-2-(phenylmethoxymethyl)-5-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 134844360 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2R,3R,4R,5R)-4-(benzenesulfonylmethyl)-2-(phenylmethoxymethyl)-5-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@H]1O[C@H](COCc2ccccc2)[C@H](O)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O5S/c1-2-9-20-19(16-28(24,25)18-12-7-4-8-13-18)22(23)21(27-20)15-26-14-17-10-5-3-6-11-17/h2-8,10-13,19-23H,1,9,14-16H2/t19-,20+,21+,22+/m0/s1 |
| InChIKey | LQEDAQDKDWZFBE-DXBBTUNJSA-N |
| XLogP | 3.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|