C26H25F3O6S2 — CID 11124519
[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-phenylsulfanyloxolan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 11124519) has the molecular formula C26H25F3O6S2 and a molecular weight of 554.61 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-phenylsulfanyloxolan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-phenylsulfanyloxolan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11124519 |
| Molecular Formula | C26H25F3O6S2 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-phenylsulfanyloxolan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC[C@H]1O[C@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H25F3O6S2/c27-26(28,29)37(30,31)34-18-22-23(32-16-19-10-4-1-5-11-19)24(33-17-20-12-6-2-7-13-20)25(35-22)36-21-14-8-3-9-15-21/h1-15,22-25H,16-18H2/t22-,23+,24-,25-/m1/s1 |
| InChIKey | VNYIDQSFIJPGOU-ZFFYZDHPSA-N |
| XLogP | 5.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|