C23H24F2O6S — CID 11190520
(5S,9S,10S)-8-(benzenesulfonyl)-6,6-difluoro-2,2-dimethyl-9-phenylmethoxy-1,3-dioxaspiro[4.5]dec-7-en-10-ol (PubChem CID 11190520) has the molecular formula C23H24F2O6S and a molecular weight of 466.50 g/mol. Its IUPAC name is (5S,9S,10S)-8-(benzenesulfonyl)-6,6-difluoro-2,2-dimethyl-9-phenylmethoxy-1,3-dioxaspiro[4.5]dec-7-en-10-ol.
| Compound Name | (5S,9S,10S)-8-(benzenesulfonyl)-6,6-difluoro-2,2-dimethyl-9-phenylmethoxy-1,3-dioxaspiro[4.5]dec-7-en-10-ol |
|---|---|
| PubChem CID | 11190520 |
| Molecular Formula | C23H24F2O6S |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (5S,9S,10S)-8-(benzenesulfonyl)-6,6-difluoro-2,2-dimethyl-9-phenylmethoxy-1,3-dioxaspiro[4.5]dec-7-en-10-ol |
| SMILES | CC1(C)OC[C@]2(O1)[C@@H](O)[C@H](OCc1ccccc1)C(S(=O)(=O)c1ccccc1)=CC2(F)F |
| InChI | InChI=1S/C23H24F2O6S/c1-21(2)30-15-22(31-21)20(26)19(29-14-16-9-5-3-6-10-16)18(13-23(22,24)25)32(27,28)17-11-7-4-8-12-17/h3-13,19-20,26H,14-15H2,1-2H3/t19-,20+,22+/m1/s1 |
| InChIKey | PWYBESJWMYMLPT-URVUXULASA-N |
| XLogP | 3.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |