C17H19FO4S — CID 102152115
(2R)-1-(4-fluorophenyl)sulfonyl-2-methyl-3-phenylmethoxypropan-2-ol (PubChem CID 102152115) has the molecular formula C17H19FO4S and a molecular weight of 338.40 g/mol. Its IUPAC name is (2R)-1-(4-fluorophenyl)sulfonyl-2-methyl-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-(4-fluorophenyl)sulfonyl-2-methyl-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 102152115 |
| Molecular Formula | C17H19FO4S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2R)-1-(4-fluorophenyl)sulfonyl-2-methyl-3-phenylmethoxypropan-2-ol |
| SMILES | C[C@@](O)(COCc1ccccc1)CS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FO4S/c1-17(19,12-22-11-14-5-3-2-4-6-14)13-23(20,21)16-9-7-15(18)8-10-16/h2-10,19H,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | RGAJMBXQWQKEPL-QGZVFWFLSA-N |
| XLogP | 2.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |