C26H38O5SSi2 — CID 135012774
(Z,1R)-3-(benzenesulfonyl)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-[dimethyl(phenyl)silyl]prop-2-en-1-ol (PubChem CID 135012774) has the molecular formula C26H38O5SSi2 and a molecular weight of 518.82 g/mol. Its IUPAC name is (Z,1R)-3-(benzenesulfonyl)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-[dimethyl(phenyl)silyl]prop-2-en-1-ol.
| Compound Name | (Z,1R)-3-(benzenesulfonyl)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-[dimethyl(phenyl)silyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 135012774 |
| Molecular Formula | C26H38O5SSi2 |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (Z,1R)-3-(benzenesulfonyl)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-[dimethyl(phenyl)silyl]prop-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC1[C@H](O)/C=C(/[Si](C)(C)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O5SSi2/c1-26(2,3)34(6,7)30-19-23-25(31-23)22(27)18-24(32(28,29)20-14-10-8-11-15-20)33(4,5)21-16-12-9-13-17-21/h8-18,22-23,25,27H,19H2,1-7H3/b24-18+/t22-,23?,25?/m1/s1 |
| InChIKey | LOTCIGNYTQXCCM-DXDWWMAQSA-N |
| XLogP | 4.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|