C23H28O6SSi — CID 135012846
[(Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]but-3-enyl] acetate (PubChem CID 135012846) has the molecular formula C23H28O6SSi and a molecular weight of 460.62 g/mol. Its IUPAC name is [(Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]but-3-enyl] acetate.
| Compound Name | [(Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 135012846 |
| Molecular Formula | C23H28O6SSi |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [(Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]but-3-enyl] acetate |
| SMILES | CC(=O)OC[C@H](/C=C(/[Si](C)(C)c1ccccc1)S(=O)(=O)c1ccccc1)[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C23H28O6SSi/c1-17(25)28-16-18(23-21(15-24)29-23)14-22(30(26,27)19-10-6-4-7-11-19)31(2,3)20-12-8-5-9-13-20/h4-14,18,21,23-24H,15-16H2,1-3H3/b22-14+/t18-,21-,23-/m0/s1 |
| InChIKey | AIOPVUGBPBGNFX-LQJXXRKVSA-N |
| XLogP | 2.44 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|