C26H44O5SSi2 — CID 138980719
2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 138980719) has the molecular formula C26H44O5SSi2 and a molecular weight of 524.87 g/mol. Its IUPAC name is 2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 138980719 |
| Molecular Formula | C26H44O5SSi2 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/C1OC(CO[Si](C)(C)C(C)(C)C)C=CC1O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H44O5SSi2/c1-9-34(10-2,11-3)25(32(28,29)22-15-13-12-14-16-22)19-24-23(27)18-17-21(31-24)20-30-33(7,8)26(4,5)6/h12-19,21,23-24,27H,9-11,20H2,1-8H3/b25-19+ |
| InChIKey | IFAHAYNOWNEUOB-NCELDCMTSA-N |
| XLogP | 6.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|