C22H32O5SSi — CID 138980718
2-[(2S)-1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 138980718) has the molecular formula C22H32O5SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is 2-[(2S)-1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 2-[(2S)-1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 138980718 |
| Molecular Formula | C22H32O5SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[(2S)-1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C#C[C@H](CS(=O)(=O)c1ccccc1)C1OC(CO[Si](C)(C)C(C)(C)C)C=CC1O |
| InChI | InChI=1S/C22H32O5SSi/c1-7-17(16-28(24,25)19-11-9-8-10-12-19)21-20(23)14-13-18(27-21)15-26-29(5,6)22(2,3)4/h1,8-14,17-18,20-21,23H,15-16H2,2-6H3/t17-,18?,20?,21?/m1/s1 |
| InChIKey | LMNXZBUKSPVELZ-LXNSYTRCSA-N |
| XLogP | 3.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|