C17H26O4SSi — CID 13174095
(1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol (PubChem CID 13174095) has the molecular formula C17H26O4SSi and a molecular weight of 354.54 g/mol. Its IUPAC name is (1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 13174095 |
| Molecular Formula | C17H26O4SSi |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (1S,4R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(S(=O)(=O)c2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C17H26O4SSi/c1-17(2,3)23(4,5)21-13-11-15(18)16(12-13)22(19,20)14-9-7-6-8-10-14/h6-10,12-13,15,18H,11H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | ITCWKNISOGETQC-HIFRSBDPSA-N |
| XLogP | 3.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|