C17H18O4S — CID 11278576
[(2S,4S,5R)-4-(benzenesulfonyl)-5-phenyloxolan-2-yl]methanol (PubChem CID 11278576) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is [(2S,4S,5R)-4-(benzenesulfonyl)-5-phenyloxolan-2-yl]methanol.
| Compound Name | [(2S,4S,5R)-4-(benzenesulfonyl)-5-phenyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 11278576 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [(2S,4S,5R)-4-(benzenesulfonyl)-5-phenyloxolan-2-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1)[C@H]1C[C@@H](CO)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18O4S/c18-12-14-11-16(17(21-14)13-7-3-1-4-8-13)22(19,20)15-9-5-2-6-10-15/h1-10,14,16-18H,11-12H2/t14-,16-,17+/m0/s1 |
| InChIKey | VJBABEZRLRXEET-BHYGNILZSA-N |
| XLogP | 2.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |