C11H16O4S — CID 15731033
(2S,3S)-1-(benzenesulfonyl)pentane-2,3-diol (PubChem CID 15731033) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is (2S,3S)-1-(benzenesulfonyl)pentane-2,3-diol.
| Compound Name | (2S,3S)-1-(benzenesulfonyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 15731033 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2S,3S)-1-(benzenesulfonyl)pentane-2,3-diol |
| SMILES | CC[C@H](O)[C@H](O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H16O4S/c1-2-10(12)11(13)8-16(14,15)9-6-4-3-5-7-9/h3-7,10-13H,2,8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | KHQKJRPXXJYLIJ-WDEREUQCSA-N |
| XLogP | 0.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |