C24H42O5SSi — CID 134931435
(E,8S,9R)-6-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldec-4-ene-1,8-diol (PubChem CID 134931435) has the molecular formula C24H42O5SSi and a molecular weight of 470.75 g/mol. Its IUPAC name is (E,8S,9R)-6-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldec-4-ene-1,8-diol.
| Compound Name | (E,8S,9R)-6-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldec-4-ene-1,8-diol |
|---|---|
| PubChem CID | 134931435 |
| Molecular Formula | C24H42O5SSi |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (E,8S,9R)-6-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldec-4-ene-1,8-diol |
| SMILES | C/C(=C\C(C[C@](C)(O)[C@@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1)CCCO |
| InChI | InChI=1S/C24H42O5SSi/c1-19(13-12-16-25)17-22(30(27,28)21-14-10-9-11-15-21)18-24(6,26)20(2)29-31(7,8)23(3,4)5/h9-11,14-15,17,20,22,25-26H,12-13,16,18H2,1-8H3/b19-17+/t20-,22?,24+/m1/s1 |
| InChIKey | KWIILNIOGJSRCK-OYALTVISSA-N |
| XLogP | 5.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|