C19H34O5SSi — CID 19430041
1-(4-methylphenyl)sulfonyl-3-tri(propan-2-yl)silylpropane-1,2,3-triol (PubChem CID 19430041) has the molecular formula C19H34O5SSi and a molecular weight of 402.63 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-tri(propan-2-yl)silylpropane-1,2,3-triol.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-tri(propan-2-yl)silylpropane-1,2,3-triol |
|---|---|
| PubChem CID | 19430041 |
| Molecular Formula | C19H34O5SSi |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-tri(propan-2-yl)silylpropane-1,2,3-triol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)C(O)C(O)[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H34O5SSi/c1-12(2)26(13(3)4,14(5)6)19(22)17(20)18(21)25(23,24)16-10-8-15(7)9-11-16/h8-14,17-22H,1-7H3 |
| InChIKey | OKPWXGRCHSFVBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|