C11H17ClO2SSi — CID 15914587
[chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane (PubChem CID 15914587) has the molecular formula C11H17ClO2SSi and a molecular weight of 276.86 g/mol. Its IUPAC name is [chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane.
| Compound Name | [chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 15914587 |
| Molecular Formula | C11H17ClO2SSi |
| Molecular Weight | 276.86 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | [chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)C(Cl)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C11H17ClO2SSi/c1-9-5-7-10(8-6-9)15(13,14)11(12)16(2,3)4/h5-8,11H,1-4H3 |
| InChIKey | WDMBPIADGNZMNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|