C9H10Br2O2S — CID 13203012
1-(1,2-dibromoethylsulfonyl)-4-methylbenzene (PubChem CID 13203012) has the molecular formula C9H10Br2O2S and a molecular weight of 342.05 g/mol. Its IUPAC name is 1-(1,2-dibromoethylsulfonyl)-4-methylbenzene.
| Compound Name | 1-(1,2-dibromoethylsulfonyl)-4-methylbenzene |
|---|---|
| PubChem CID | 13203012 |
| Molecular Formula | C9H10Br2O2S |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 1-(1,2-dibromoethylsulfonyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(Br)CBr)cc1 |
| InChI | InChI=1S/C9H10Br2O2S/c1-7-2-4-8(5-3-7)14(12,13)9(11)6-10/h2-5,9H,6H2,1H3 |
| InChIKey | YQPQWTSGBYPXCV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|