C12H16O7S — CID 88704819
(2R,3R,4R)-2,3,4,5-tetrahydroxy-5-(4-methylphenyl)sulfonylpentanal (PubChem CID 88704819) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-5-(4-methylphenyl)sulfonylpentanal.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-5-(4-methylphenyl)sulfonylpentanal |
|---|---|
| PubChem CID | 88704819 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-5-(4-methylphenyl)sulfonylpentanal |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@H](O)[C@H](O)[C@@H](O)C=O)cc1 |
| InChI | InChI=1S/C12H16O7S/c1-7-2-4-8(5-3-7)20(18,19)12(17)11(16)10(15)9(14)6-13/h2-6,9-12,14-17H,1H3/t9-,10+,11+,12?/m0/s1 |
| InChIKey | HYUDMUPWOACZAW-YZTHKRDXSA-N |
| XLogP | -1.63 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|