C12H18O7S — CID 171061381
(2S,3S,4R)-1-(4-methylphenyl)sulfonylpentane-1,2,3,4,5-pentol (PubChem CID 171061381) has the molecular formula C12H18O7S and a molecular weight of 306.34 g/mol. Its IUPAC name is (2S,3S,4R)-1-(4-methylphenyl)sulfonylpentane-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4R)-1-(4-methylphenyl)sulfonylpentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 171061381 |
| Molecular Formula | C12H18O7S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2S,3S,4R)-1-(4-methylphenyl)sulfonylpentane-1,2,3,4,5-pentol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@@H](O)[C@@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C12H18O7S/c1-7-2-4-8(5-3-7)20(18,19)12(17)11(16)10(15)9(14)6-13/h2-5,9-17H,6H2,1H3/t9-,10+,11+,12?/m1/s1 |
| InChIKey | YGGDZFQNOARRDT-FEZOTEKNSA-N |
| XLogP | -1.84 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |