C28H24O3S — CID 123934939
2-(4-methylphenyl)sulfonyl-3,3,3-triphenylpropanal (PubChem CID 123934939) has the molecular formula C28H24O3S and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-3,3,3-triphenylpropanal.
| Compound Name | 2-(4-methylphenyl)sulfonyl-3,3,3-triphenylpropanal |
|---|---|
| PubChem CID | 123934939 |
| Molecular Formula | C28H24O3S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-3,3,3-triphenylpropanal |
| SMILES | Cc1ccc(S(=O)(=O)C(C=O)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O3S/c1-22-17-19-26(20-18-22)32(30,31)27(21-29)28(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-21,27H,1H3 |
| InChIKey | CWDFZFZJNJPASP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|