C25H42O4SSi — CID 11784586
4-(benzenesulfonyl)-4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol (PubChem CID 11784586) has the molecular formula C25H42O4SSi and a molecular weight of 466.76 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol.
| Compound Name | 4-(benzenesulfonyl)-4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 11784586 |
| Molecular Formula | C25H42O4SSi |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 4-(benzenesulfonyl)-4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
| SMILES | CC1=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1C(CC(C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H42O4SSi/c1-18-15-16-22(29-31(8,9)24(3,4)5)25(6,7)23(18)21(17-19(2)26)30(27,28)20-13-11-10-12-14-20/h10-15,19,21-23,26H,16-17H2,1-9H3/t19?,21?,22-,23-/m0/s1 |
| InChIKey | NKQNWRATFMEBSW-VZKWCCSDSA-N |
| XLogP | 5.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|