C44H66O4SSi2 — CID 10533081
[(5E,9E)-3-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-2-propan-2-ylundeca-5,9-dienoxy]-tert-butyl-diphenylsilane (PubChem CID 10533081) has the molecular formula C44H66O4SSi2 and a molecular weight of 747.25 g/mol. Its IUPAC name is [(5E,9E)-3-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-2-propan-2-ylundeca-5,9-dienoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(5E,9E)-3-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-2-propan-2-ylundeca-5,9-dienoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10533081 |
| Molecular Formula | C44H66O4SSi2 |
| Molecular Weight | 747.25 g/mol |
| Exact Mass | 746.42 |
| IUPAC Name | [(5E,9E)-3-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-2-propan-2-ylundeca-5,9-dienoxy]-tert-butyl-diphenylsilane |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)CC/C=C(\C)CC(C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C44H66O4SSi2/c1-35(2)41(34-48-51(44(8,9)10,39-27-18-14-19-28-39)40-29-20-15-21-30-40)42(49(45,46)38-25-16-13-17-26-38)33-37(4)24-22-23-36(3)31-32-47-50(11,12)43(5,6)7/h13-21,24-31,35,41-42H,22-23,32-34H2,1-12H3/b36-31+,37-24+ |
| InChIKey | BDSOFDINYGTFRH-CDGPPTRFSA-N |
| XLogP | 10.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.25 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|