C54H96O8S2Si4 — CID 139115544
[(1S,2S,3R,6R)-5-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylcyclohept-4-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 139115544) has the molecular formula C54H96O8S2Si4 and a molecular weight of 1049.83 g/mol. Its IUPAC name is [(1S,2S,3R,6R)-5-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylcyclohept-4-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,3R,6R)-5-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylcyclohept-4-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139115544 |
| Molecular Formula | C54H96O8S2Si4 |
| Molecular Weight | 1049.83 g/mol |
| Exact Mass | 1048.56 |
| IUPAC Name | [(1S,2S,3R,6R)-5-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylcyclohept-4-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(S(=O)(=O)c2ccccc2)[C@H](C)C[C@@H]1O[Si](C)(C)C(C)(C)C.C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(S(=O)(=O)c2ccccc2)[C@H](C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/2C27H48O4SSi2/c2*1-20-18-23(30-33(9,10)26(3,4)5)21(2)24(31-34(11,12)27(6,7)8)19-25(20)32(28,29)22-16-14-13-15-17-22/h2*13-17,19-21,23-24H,18H2,1-12H3/t2*20-,21+,23+,24+/m11/s1 |
| InChIKey | YGSUEYNTYJXSSA-ZYMAKHSJSA-N |
| XLogP | 15.60 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.83 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|