C42H68O8S2Si2 — CID 139117920
(1R,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol (PubChem CID 139117920) has the molecular formula C42H68O8S2Si2 and a molecular weight of 821.30 g/mol. Its IUPAC name is (1R,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol.
| Compound Name | (1R,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 139117920 |
| Molecular Formula | C42H68O8S2Si2 |
| Molecular Weight | 821.30 g/mol |
| Exact Mass | 820.39 |
| IUPAC Name | (1R,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol |
| SMILES | C[C@H]1[C@@H](O)[C@H](C)C(S(=O)(=O)c2ccccc2)=CC[C@@H]1O[Si](C)(C)C(C)(C)C.C[C@H]1[C@@H](O)[C@H](C)C(S(=O)(=O)c2ccccc2)=CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/2C21H34O4SSi/c2*1-15-18(25-27(6,7)21(3,4)5)13-14-19(16(2)20(15)22)26(23,24)17-11-9-8-10-12-17/h2*8-12,14-16,18,20,22H,13H2,1-7H3/t2*15-,16-,18+,20-/m11/s1 |
| InChIKey | JMWWPONITVQYNK-JQFYYLJKSA-N |
| XLogP | 9.54 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.30 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|