C35H46O4SSi — CID 11467431
(3S)-1-(benzenesulfonyl)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol (PubChem CID 11467431) has the molecular formula C35H46O4SSi and a molecular weight of 590.90 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol.
| Compound Name | (3S)-1-(benzenesulfonyl)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 11467431 |
| Molecular Formula | C35H46O4SSi |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
| SMILES | CC1=CCCC(C)(C)[C@@H]1C(C(O)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H46O4SSi/c1-26-18-17-25-35(6,7)31(26)33(40(37,38)28-19-11-8-12-20-28)32(36)27(2)39-41(34(3,4)5,29-21-13-9-14-22-29)30-23-15-10-16-24-30/h8-16,18-24,27,31-33,36H,17,25H2,1-7H3/t27-,31-,32?,33?/m0/s1 |
| InChIKey | PAQJSWIAVQRISW-IQHQDNLQSA-N |
| XLogP | 6.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|