C19H24O2SSi — CID 11057075
(E,1S)-2-[(S)-(4-methylphenyl)sulfinyl]-1-phenyl-3-trimethylsilylprop-2-en-1-ol (PubChem CID 11057075) has the molecular formula C19H24O2SSi and a molecular weight of 344.55 g/mol. Its IUPAC name is (E,1S)-2-[(S)-(4-methylphenyl)sulfinyl]-1-phenyl-3-trimethylsilylprop-2-en-1-ol.
| Compound Name | (E,1S)-2-[(S)-(4-methylphenyl)sulfinyl]-1-phenyl-3-trimethylsilylprop-2-en-1-ol |
|---|---|
| PubChem CID | 11057075 |
| Molecular Formula | C19H24O2SSi |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E,1S)-2-[(S)-(4-methylphenyl)sulfinyl]-1-phenyl-3-trimethylsilylprop-2-en-1-ol |
| SMILES | Cc1ccc([S@](=O)/C(=C/[Si](C)(C)C)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24O2SSi/c1-15-10-12-17(13-11-15)22(21)18(14-23(2,3)4)19(20)16-8-6-5-7-9-16/h5-14,19-20H,1-4H3/b18-14+/t19-,22-/m0/s1 |
| InChIKey | BOHVPEDJEILETH-OZHIUDEQSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|