C31H42O7SSi — CID 10995505
(2R)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6,6,6-trimethoxyhexan-2-ol (PubChem CID 10995505) has the molecular formula C31H42O7SSi and a molecular weight of 586.82 g/mol. Its IUPAC name is (2R)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6,6,6-trimethoxyhexan-2-ol.
| Compound Name | (2R)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6,6,6-trimethoxyhexan-2-ol |
|---|---|
| PubChem CID | 10995505 |
| Molecular Formula | C31H42O7SSi |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | (2R)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6,6,6-trimethoxyhexan-2-ol |
| SMILES | COC(CC(C[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C31H42O7SSi/c1-30(2,3)40(28-18-12-8-13-19-28,29-20-14-9-15-21-29)38-24-25(32)22-27(23-31(35-4,36-5)37-6)39(33,34)26-16-10-7-11-17-26/h7-21,25,27,32H,22-24H2,1-6H3/t25-,27?/m1/s1 |
| InChIKey | DUYACSDKFZHDEO-CSMDKSQMSA-N |
| XLogP | 4.14 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|