C25H33BrO6S2Si — CID 10698837
(1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol (PubChem CID 10698837) has the molecular formula C25H33BrO6S2Si and a molecular weight of 601.66 g/mol. Its IUPAC name is (1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol.
| Compound Name | (1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10698837 |
| Molecular Formula | C25H33BrO6S2Si |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | (1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](Br)[C@@H](O)C=C[C@H]1C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H33BrO6S2Si/c1-25(2,3)35(4,5)32-23-20(16-17-21(27)22(23)26)24(33(28,29)18-12-8-6-9-13-18)34(30,31)19-14-10-7-11-15-19/h6-17,20-24,27H,1-5H3/t20-,21+,22+,23+/m1/s1 |
| InChIKey | NDEQOSGCPFRZRZ-LDVJMBRRSA-N |
| XLogP | 4.96 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|