C28H33BrO2SSi — CID 134884761
[(Z)-5-(benzenesulfinyl)-6-bromohex-4-enoxy]-tert-butyl-diphenylsilane (PubChem CID 134884761) has the molecular formula C28H33BrO2SSi and a molecular weight of 541.63 g/mol. Its IUPAC name is [(Z)-5-(benzenesulfinyl)-6-bromohex-4-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(Z)-5-(benzenesulfinyl)-6-bromohex-4-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134884761 |
| Molecular Formula | C28H33BrO2SSi |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | [(Z)-5-(benzenesulfinyl)-6-bromohex-4-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC/C=C(/CBr)S(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33BrO2SSi/c1-28(2,3)33(26-18-9-5-10-19-26,27-20-11-6-12-21-27)31-22-14-13-17-25(23-29)32(30)24-15-7-4-8-16-24/h4-12,15-21H,13-14,22-23H2,1-3H3/b25-17- |
| InChIKey | CYRXBHOXGYAAQL-UQQQWYQISA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|