C26H31FO3SSi — CID 10719175
tert-butyl-[4-(4-fluorophenyl)sulfonylbutoxy]-diphenylsilane (PubChem CID 10719175) has the molecular formula C26H31FO3SSi and a molecular weight of 470.68 g/mol. Its IUPAC name is tert-butyl-[4-(4-fluorophenyl)sulfonylbutoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(4-fluorophenyl)sulfonylbutoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10719175 |
| Molecular Formula | C26H31FO3SSi |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | tert-butyl-[4-(4-fluorophenyl)sulfonylbutoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCS(=O)(=O)c1ccc(F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31FO3SSi/c1-26(2,3)32(24-12-6-4-7-13-24,25-14-8-5-9-15-25)30-20-10-11-21-31(28,29)23-18-16-22(27)17-19-23/h4-9,12-19H,10-11,20-21H2,1-3H3 |
| InChIKey | JZPLBHDQTWMQQQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|