C30H39NO3SSi — CID 10720794
(Z,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol (PubChem CID 10720794) has the molecular formula C30H39NO3SSi and a molecular weight of 521.80 g/mol. Its IUPAC name is (Z,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol.
| Compound Name | (Z,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 10720794 |
| Molecular Formula | C30H39NO3SSi |
| Molecular Weight | 521.80 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (Z,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol |
| SMILES | CN=S(=O)(/C=C\[C@@H](C)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H39NO3SSi/c1-25(22-24-35(33,31-5)26-15-9-6-10-16-26)29(32)21-23-34-36(30(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,22,24-25,29,32H,21,23H2,1-5H3/b24-22-/t25-,29+,35?/m1/s1 |
| InChIKey | KLZMTVWEBYZMME-JEIJPHQJSA-N |
| XLogP | 5.62 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|