C37H44O6SSi — CID 134844711
(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(phenylmethoxymethyl)oxolan-3-ol (PubChem CID 134844711) has the molecular formula C37H44O6SSi and a molecular weight of 644.91 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(phenylmethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(phenylmethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 134844711 |
| Molecular Formula | C37H44O6SSi |
| Molecular Weight | 644.91 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(phenylmethoxymethyl)oxolan-3-ol |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1O[C@H](COCc2ccccc2)[C@H](O)[C@H]1CS(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44O6SSi/c1-37(2,3)45(31-20-12-6-13-21-31,32-22-14-7-15-23-32)42-25-24-34-33(28-44(39,40)30-18-10-5-11-19-30)36(38)35(43-34)27-41-26-29-16-8-4-9-17-29/h4-23,33-36,38H,24-28H2,1-3H3/t33-,34-,35+,36+/m0/s1 |
| InChIKey | ICGLZDPCFZWQDA-CLLHQPRTSA-N |
| XLogP | 5.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|