C37H50O7SSi — CID 162786686
tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-(2-methylprop-2-enylsulfonyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]silane (PubChem CID 162786686) has the molecular formula C37H50O7SSi and a molecular weight of 666.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-(2-methylprop-2-enylsulfonyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-(2-methylprop-2-enylsulfonyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 162786686 |
| Molecular Formula | C37H50O7SSi |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,3R,4S,5R)-6-(2-methylprop-2-enylsulfonyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]silane |
| SMILES | C=C(C)CS(=O)(=O)C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H50O7SSi/c1-28(2)27-45(38,39)36-35(42-25-31-21-15-10-16-22-31)34(41-24-30-19-13-9-14-20-30)33(40-23-29-17-11-8-12-18-29)32(44-36)26-43-46(6,7)37(3,4)5/h8-22,32-36H,1,23-27H2,2-7H3/t32-,33-,34+,35-,36?/m1/s1 |
| InChIKey | AQCDYPTZWPFDGY-KXCACMGXSA-N |
| XLogP | 7.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|