C17H25N3O3S — CID 72932746
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 72932746) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 72932746 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H25N3O3S/c1-13(2)6-4-7-14(3)10-11-19-17(21)20-15-8-5-9-16(12-15)24(18,22)23/h5-6,8-10,12H,4,7,11H2,1-3H3,(H2,18,22,23)(H2,19,20,21)/b14-10+ |
| InChIKey | LOZPDXGKKGAZPC-GXDHUFHOSA-N |
| XLogP | 3.15 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|