C33H45N3O4S — CID 10393422
(3E,7E)-N-[3-[3-[(2,3-dimethylphenyl)sulfamoyl]anilino]-3-oxopropyl]-4,8,12-trimethyltrideca-3,7,11-trienamide (PubChem CID 10393422) has the molecular formula C33H45N3O4S and a molecular weight of 579.81 g/mol. Its IUPAC name is (3E,7E)-N-[3-[3-[(2,3-dimethylphenyl)sulfamoyl]anilino]-3-oxopropyl]-4,8,12-trimethyltrideca-3,7,11-trienamide.
| Compound Name | (3E,7E)-N-[3-[3-[(2,3-dimethylphenyl)sulfamoyl]anilino]-3-oxopropyl]-4,8,12-trimethyltrideca-3,7,11-trienamide |
|---|---|
| PubChem CID | 10393422 |
| Molecular Formula | C33H45N3O4S |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | (3E,7E)-N-[3-[3-[(2,3-dimethylphenyl)sulfamoyl]anilino]-3-oxopropyl]-4,8,12-trimethyltrideca-3,7,11-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(=O)NCCC(=O)Nc1cccc(S(=O)(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C33H45N3O4S/c1-24(2)11-7-12-25(3)13-8-14-26(4)19-20-32(37)34-22-21-33(38)35-29-16-10-17-30(23-29)41(39,40)36-31-18-9-15-27(5)28(31)6/h9-11,13,15-19,23,36H,7-8,12,14,20-22H2,1-6H3,(H,34,37)(H,35,38)/b25-13+,26-19+ |
| InChIKey | GYEIMWDCOLSUKW-OXSKGNKOSA-N |
| XLogP | 7.36 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|