C16H26N4O3S — CID 55820095
1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 55820095) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 55820095 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | CC1CC(C)CN(CCNC(=O)Nc2cccc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C16H26N4O3S/c1-12-8-13(2)11-20(10-12)7-6-18-16(21)19-14-4-3-5-15(9-14)24(17,22)23/h3-5,9,12-13H,6-8,10-11H2,1-2H3,(H2,17,22,23)(H2,18,19,21) |
| InChIKey | FZZYFRMJMNXECV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |