C17H27N3O — CID 51952341
1-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethyl]urea (PubChem CID 51952341) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethyl]urea.
| Compound Name | 1-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 51952341 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethyl]urea |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCNC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O/c1-14-10-15(2)13-20(12-14)9-8-18-17(21)19-11-16-6-4-3-5-7-16/h3-7,14-15H,8-13H2,1-2H3,(H2,18,19,21)/t14-,15-/m1/s1 |
| InChIKey | CDTMAWVZYVJMJE-HUUCEWRRSA-N |
| XLogP | 2.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |