C23H40N4O — CID 55931996
1-[1-(dimethylamino)-3-phenylpropan-2-yl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea (PubChem CID 55931996) has the molecular formula C23H40N4O and a molecular weight of 388.60 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-3-phenylpropan-2-yl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea.
| Compound Name | 1-[1-(dimethylamino)-3-phenylpropan-2-yl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 55931996 |
| Molecular Formula | C23H40N4O |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | 1-[1-(dimethylamino)-3-phenylpropan-2-yl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea |
| SMILES | CC1CC(C)CN(CCCCNC(=O)NC(Cc2ccccc2)CN(C)C)C1 |
| InChI | InChI=1S/C23H40N4O/c1-19-14-20(2)17-27(16-19)13-9-8-12-24-23(28)25-22(18-26(3)4)15-21-10-6-5-7-11-21/h5-7,10-11,19-20,22H,8-9,12-18H2,1-4H3,(H2,24,25,28) |
| InChIKey | CRDIOKDRGZBNDM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|