C16H33N3O2 — CID 110894449
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 110894449) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 110894449 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NCCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C16H33N3O2/c1-4-15(12-20)18-16(21)17-7-5-6-8-19-10-13(2)9-14(3)11-19/h13-15,20H,4-12H2,1-3H3,(H2,17,18,21) |
| InChIKey | DYNMZMUAVVFJRC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|