C19H30ClN3O — CID 55767047
1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea (PubChem CID 55767047) has the molecular formula C19H30ClN3O and a molecular weight of 351.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 55767047 |
| Molecular Formula | C19H30ClN3O |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)butyl]urea |
| SMILES | CC1CC(C)CN(CCCCNC(=O)NCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H30ClN3O/c1-15-11-16(2)14-23(13-15)10-4-3-9-21-19(24)22-12-17-5-7-18(20)8-6-17/h5-8,15-16H,3-4,9-14H2,1-2H3,(H2,21,22,24) |
| InChIKey | UNRBHUMCKBTVBJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|