C25H40N4O2 — CID 52506535
1-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]butyl]urea (PubChem CID 52506535) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]butyl]urea.
| Compound Name | 1-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 52506535 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 1-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]butyl]urea |
| SMILES | C[C@@H]1CCCN(CCCCNC(=O)NCc2ccc(C(=O)N3CCCC[C@@H]3C)cc2)C1 |
| InChI | InChI=1S/C25H40N4O2/c1-20-8-7-16-28(19-20)15-6-4-14-26-25(31)27-18-22-10-12-23(13-11-22)24(30)29-17-5-3-9-21(29)2/h10-13,20-21H,3-9,14-19H2,1-2H3,(H2,26,27,31)/t20-,21+/m1/s1 |
| InChIKey | QYCFUCZZNWMFKY-RTWAWAEBSA-N |
| XLogP | 4.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|