C18H37N3O2 — CID 111120987
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea (PubChem CID 111120987) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111120987 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea |
| SMILES | CC1CC(C)CN(CCCCNC(=O)NCC(C)(O)C(C)C)C1 |
| InChI | InChI=1S/C18H37N3O2/c1-14(2)18(5,23)13-20-17(22)19-8-6-7-9-21-11-15(3)10-16(4)12-21/h14-16,23H,6-13H2,1-5H3,(H2,19,20,22) |
| InChIKey | LTUQLMVPTWMZMR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|