C20H32N2O2 — CID 98774084
(2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-phenylmethoxypropanamide (PubChem CID 98774084) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-phenylmethoxypropanamide.
| Compound Name | (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 98774084 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-phenylmethoxypropanamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)[C@H](C)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H32N2O2/c1-16-12-17(2)14-22(13-16)11-7-10-21-20(23)18(3)24-15-19-8-5-4-6-9-19/h4-6,8-9,16-18H,7,10-15H2,1-3H3,(H,21,23)/t16-,17-,18+/m1/s1 |
| InChIKey | CZOWIWSSWVIEBF-KURKYZTESA-N |
| XLogP | 3.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|