C12H14N4O3S2 — CID 167748185
1-(3-sulfamoylphenyl)-3-[2-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 167748185) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(3-sulfamoylphenyl)-3-[2-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-(3-sulfamoylphenyl)-3-[2-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 167748185 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(3-sulfamoylphenyl)-3-[2-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)NCCc2nccs2)c1 |
| InChI | InChI=1S/C12H14N4O3S2/c13-21(18,19)10-3-1-2-9(8-10)16-12(17)15-5-4-11-14-6-7-20-11/h1-3,6-8H,4-5H2,(H2,13,18,19)(H2,15,16,17) |
| InChIKey | NNIUCAPPEQJIBF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |