C13H15N3O3S2 — CID 110446219
2-(benzenesulfonamido)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 110446219) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110446219 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCCc1nccs1 |
| InChI | InChI=1S/C13H15N3O3S2/c17-12(14-7-6-13-15-8-9-20-13)10-16-21(18,19)11-4-2-1-3-5-11/h1-5,8-9,16H,6-7,10H2,(H,14,17) |
| InChIKey | XFXNKDYCFBNESK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |