C15H15N5OS — CID 110446261
2-(quinazolin-4-ylamino)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 110446261) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-(quinazolin-4-ylamino)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(quinazolin-4-ylamino)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110446261 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(quinazolin-4-ylamino)-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | O=C(CNc1ncnc2ccccc12)NCCc1nccs1 |
| InChI | InChI=1S/C15H15N5OS/c21-13(16-6-5-14-17-7-8-22-14)9-18-15-11-3-1-2-4-12(11)19-10-20-15/h1-4,7-8,10H,5-6,9H2,(H,16,21)(H,18,19,20) |
| InChIKey | BWFOPSBHQBMEHU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |