C17H21N3O5S2 — CID 166212100
2-(benzenesulfonamido)-N-[2-(benzylsulfonylamino)ethyl]acetamide (PubChem CID 166212100) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(benzylsulfonylamino)ethyl]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(benzylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 166212100 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(benzylsulfonylamino)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCCNS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H21N3O5S2/c21-17(13-20-27(24,25)16-9-5-2-6-10-16)18-11-12-19-26(22,23)14-15-7-3-1-4-8-15/h1-10,19-20H,11-14H2,(H,18,21) |
| InChIKey | SJFQYQKHXDYVNX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|