C14H21N3O3S — CID 2190794
N-[2-(benzenesulfonamido)ethyl]-2-pyrrolidin-1-ylacetamide (PubChem CID 2190794) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 2190794 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(CN1CCCC1)NCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O3S/c18-14(12-17-10-4-5-11-17)15-8-9-16-21(19,20)13-6-2-1-3-7-13/h1-3,6-7,16H,4-5,8-12H2,(H,15,18) |
| InChIKey | DRHKLEXEDDTPKP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|