C24H37N — CID 159524764
ethane;(6Z)-2,2,7,11-tetramethyl-4-phenyldodeca-6,10-dienenitrile (PubChem CID 159524764) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is ethane;(6Z)-2,2,7,11-tetramethyl-4-phenyldodeca-6,10-dienenitrile.
| Compound Name | ethane;(6Z)-2,2,7,11-tetramethyl-4-phenyldodeca-6,10-dienenitrile |
|---|---|
| PubChem CID | 159524764 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | ethane;(6Z)-2,2,7,11-tetramethyl-4-phenyldodeca-6,10-dienenitrile |
| SMILES | CC.CC(C)=CCC/C(C)=C\CC(CC(C)(C)C#N)c1ccccc1 |
| InChI | InChI=1S/C22H31N.C2H6/c1-18(2)10-9-11-19(3)14-15-21(16-22(4,5)17-23)20-12-7-6-8-13-20;1-2/h6-8,10,12-14,21H,9,11,15-16H2,1-5H3;1-2H3/b19-14-; |
| InChIKey | MCGBFRLJMJSUBN-YEBWQKSTSA-N |
| XLogP | 7.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|