C29H42N2O4S — CID 149080973
4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-4-oxo-2-phenylbutanoic acid (PubChem CID 149080973) has the molecular formula C29H42N2O4S and a molecular weight of 514.73 g/mol. Its IUPAC name is 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 149080973 |
| Molecular Formula | C29H42N2O4S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-4-oxo-2-phenylbutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)CC(C(=O)O)c1ccccc1)C(=O)CN |
| InChI | InChI=1S/C29H42N2O4S/c1-21(2)10-8-11-22(3)12-9-13-23(4)16-17-36-20-26(27(32)19-30)31-28(33)18-25(29(34)35)24-14-6-5-7-15-24/h5-7,10,12,14-16,25-26H,8-9,11,13,17-20,30H2,1-4H3,(H,31,33)(H,34,35)/b22-12+,23-16+/t25?,26-/m0/s1 |
| InChIKey | QQHXVPGOWHRTLM-FOKACHAHSA-N |
| XLogP | 5.41 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|